CAS 1025720-99-3 appears in our catalog under these names: 3,4-Dichloropicolinamide, 95%, 3,4-Dichloropicolinamide, 98%, 3,4-Dichloropicolinamide, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
3,4-dichloropyridine-2-carboxamide (CAS 1025720-99-3) is a chemical compound with the molecular formula C6H4Cl2N2O and a molecular weight of 191.01 g/mol. IUPAC name: 3,4-dichloropyridine-2-carboxamide. InChIKey: QEYCCTFCRIPTDO-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O |
|---|---|
| Molecular weight | 191.01 g/mol |
| IUPAC name | 3,4-dichloropyridine-2-carboxamide |
| InChIKey | QEYCCTFCRIPTDO-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1Cl)Cl)C(=O)N |
Computed by PubChem (NCBI)