Products 1375065-71-6
CAS 1375065-71-6 appears in our catalog under these names: 4,5-Dichloronicotinamide, 95%, 4,5-Dichloronicotinamide, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
4,5-dichloropyridine-3-carboxamide (CAS 1375065-71-6) is a chemical compound with the molecular formula C6H4Cl2N2O and a molecular weight of 191.01 g/mol. IUPAC name: 4,5-dichloropyridine-3-carboxamide. InChIKey: PKIYBGKVKDSMSC-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O |
|---|---|
| Molecular weight | 191.01 g/mol |
| IUPAC name | 4,5-dichloropyridine-3-carboxamide |
| InChIKey | PKIYBGKVKDSMSC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)Cl)Cl)C(=O)N |
Computed by PubChem (NCBI)