CAS 1009562-96-2 is the registry number for N-Hydroxy-(5-chloropyridine)-2-carbonimidoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2Z)-5-chloro-N-hydroxypyridine-2-carboximidoyl chloride (CAS 1009562-96-2) is a chemical compound with the molecular formula C6H4Cl2N2O and a molecular weight of 191.01 g/mol. IUPAC name: (2Z)-5-chloro-N-hydroxypyridine-2-carboximidoyl chloride. InChIKey: GBBSGMJSYPKLEZ-POHAHGRESA-N.
| Molecular formula | C6H4Cl2N2O |
|---|---|
| Molecular weight | 191.01 g/mol |
| IUPAC name | (2Z)-5-chloro-N-hydroxypyridine-2-carboximidoyl chloride |
| InChIKey | GBBSGMJSYPKLEZ-POHAHGRESA-N |
| SMILES | C1=CC(=NC=C1Cl)/C(=N/O)/Cl |
Computed by PubChem (NCBI)