cas: 178974-97-5 — see every product listed under this CAS number, including other names
2,4-Difluoro-3-methoxybenzoic Acid, >98.0%(GC)(T) (CAS 178974-97-5) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D5309-1G |
| cas | 178974-97-5 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 231.44 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
2,4-difluoro-3-methoxybenzoic acid (CAS 178974-97-5) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: 2,4-difluoro-3-methoxybenzoic acid. InChIKey: KWLIGHXPUYUTBH-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O3 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 2,4-difluoro-3-methoxybenzoic acid |
| InChIKey | KWLIGHXPUYUTBH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1F)C(=O)O)F |
Computed by PubChem (NCBI)