cas: 178974-97-5 — see every product listed under this CAS number, including other names
2,4-Difluoro-3-methoxybenzoic acid, 98% (CAS 178974-97-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g, 100g, 1g. Offered by: Combi-blocks, AmBeed, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | OR-5313-25g |
| cas | 178974-97-5 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 100g | price on request | |
| Combi-blocks | 1g | price on request | |
| AmBeed | 1g | 239.26 Pln | |
| AmBeed | 5g | 662.41 Pln | |
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 419.66 Pln | |
| Fluorochem | 25g | 1528.65 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2,4-difluoro-3-methoxybenzoic acid (CAS 178974-97-5) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: 2,4-difluoro-3-methoxybenzoic acid. InChIKey: KWLIGHXPUYUTBH-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O3 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | 2,4-difluoro-3-methoxybenzoic acid |
| InChIKey | KWLIGHXPUYUTBH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1F)C(=O)O)F |
Computed by PubChem (NCBI)