cas: 1162257-25-1 — see every product listed under this CAS number, including other names
2,4-Difluoro-6-methoxybenzene-1-sulfonyl chloride, 95% (CAS 1162257-25-1) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1135171-5g |
| cas | 1162257-25-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 16956.94 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,4-difluoro-6-methoxybenzenesulfonyl chloride (CAS 1162257-25-1) is a chemical compound with the molecular formula C7H5ClF2O3S and a molecular weight of 242.63 g/mol. IUPAC name: 2,4-difluoro-6-methoxybenzenesulfonyl chloride. InChIKey: SABUOZCZXYQATB-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF2O3S |
|---|---|
| Molecular weight | 242.63 g/mol |
| IUPAC name | 2,4-difluoro-6-methoxybenzenesulfonyl chloride |
| InChIKey | SABUOZCZXYQATB-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)