Products 1706458-18-5

CAS 1706458-18-5 appears in our catalog under these names: 2,6-Difluoro-3-methoxybenzenesulfonyl chloride, 95%, 2,6-Difluoro-3-methoxybenzenesulfonyl chloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2,6-difluoro-3-methoxybenzenesulfonyl chloride (CAS 1706458-18-5) is a chemical compound with the molecular formula C7H5ClF2O3S and a molecular weight of 242.63 g/mol. IUPAC name: 2,6-difluoro-3-methoxybenzenesulfonyl chloride. InChIKey: CMGSWXSQYXKQHV-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5ClF2O3S
Molecular weight242.63 g/mol
IUPAC name2,6-difluoro-3-methoxybenzenesulfonyl chloride
InChIKeyCMGSWXSQYXKQHV-UHFFFAOYSA-N
SMILESCOC1=C(C(=C(C=C1)F)S(=O)(=O)Cl)F

Computed by PubChem (NCBI)