CAS 1178236-98-0 appears in our catalog under these names: 3,5-Difluoro-4-methoxybenzene-1-sulfonyl chloride, 97%, 3,5-Difluoro-4-methoxybenzenesulfonyl chloride. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
3,5-difluoro-4-methoxybenzenesulfonyl chloride (CAS 1178236-98-0) is a chemical compound with the molecular formula C7H5ClF2O3S and a molecular weight of 242.63 g/mol. IUPAC name: 3,5-difluoro-4-methoxybenzenesulfonyl chloride. InChIKey: KFFHNAWTMVKBID-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF2O3S |
|---|---|
| Molecular weight | 242.63 g/mol |
| IUPAC name | 3,5-difluoro-4-methoxybenzenesulfonyl chloride |
| InChIKey | KFFHNAWTMVKBID-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1F)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)