CAS 1261825-36-8 is the registry number for 4,5-Difluoro-2-methoxybenzene-1-sulfonyl chloride, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
4,5-difluoro-2-methoxybenzenesulfonyl chloride (CAS 1261825-36-8) is a chemical compound with the molecular formula C7H5ClF2O3S and a molecular weight of 242.63 g/mol. IUPAC name: 4,5-difluoro-2-methoxybenzenesulfonyl chloride. InChIKey: MARRIMPKLITFCM-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF2O3S |
|---|---|
| Molecular weight | 242.63 g/mol |
| IUPAC name | 4,5-difluoro-2-methoxybenzenesulfonyl chloride |
| InChIKey | MARRIMPKLITFCM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1S(=O)(=O)Cl)F)F |
Computed by PubChem (NCBI)