Products 1162257-25-1
CAS 1162257-25-1 appears in our catalog under these names: 2,4-Difluoro-6-methoxybenzene-1-sulfonyl chloride, 2,4-Difluoro-6-methoxybenzene-1-sulfonyl chloride, 96%, 2,4-Difluoro-6-methoxybenzene-1-sulfonyl chloride, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 0,5g, 50mg, 1g, 100mg, 250mg, 5g.
2,4-difluoro-6-methoxybenzenesulfonyl chloride (CAS 1162257-25-1) is a chemical compound with the molecular formula C7H5ClF2O3S and a molecular weight of 242.63 g/mol. IUPAC name: 2,4-difluoro-6-methoxybenzenesulfonyl chloride. InChIKey: SABUOZCZXYQATB-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF2O3S |
|---|---|
| Molecular weight | 242.63 g/mol |
| IUPAC name | 2,4-difluoro-6-methoxybenzenesulfonyl chloride |
| InChIKey | SABUOZCZXYQATB-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)