Products 1162257-25-1

CAS 1162257-25-1 appears in our catalog under these names: 2,4-Difluoro-6-methoxybenzene-1-sulfonyl chloride, 2,4-Difluoro-6-methoxybenzene-1-sulfonyl chloride, 96%, 2,4-Difluoro-6-methoxybenzene-1-sulfonyl chloride, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 0,5g, 50mg, 1g, 100mg, 250mg, 5g.

Structural formula: {0} (CAS {1})

2,4-difluoro-6-methoxybenzenesulfonyl chloride (CAS 1162257-25-1) is a chemical compound with the molecular formula C7H5ClF2O3S and a molecular weight of 242.63 g/mol. IUPAC name: 2,4-difluoro-6-methoxybenzenesulfonyl chloride. InChIKey: SABUOZCZXYQATB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5ClF2O3S
Molecular weight242.63 g/mol
IUPAC name2,4-difluoro-6-methoxybenzenesulfonyl chloride
InChIKeySABUOZCZXYQATB-UHFFFAOYSA-N
SMILESCOC1=C(C(=CC(=C1)F)F)S(=O)(=O)Cl

Computed by PubChem (NCBI)