CAS 351003-34-4 appears in our catalog under these names: 4–(Difluoromethoxy)benzenesulfonyl chloride, 4-(Difluoromethoxy)benzenesulfonyl chloride, 95%, 4-(Difluoromethoxy)benzene-1-sulfonyl chloride, 98%. Offered by: GLPBio, Fluorochem, Ambeed. Available pack sizes: 10g, 1g, 5g, 25g.
4-(difluoromethoxy)benzenesulfonyl chloride (CAS 351003-34-4) is a chemical compound with the molecular formula C7H5ClF2O3S and a molecular weight of 242.63 g/mol. IUPAC name: 4-(difluoromethoxy)benzenesulfonyl chloride. InChIKey: ANZLDHZFNLCQAS-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF2O3S |
|---|---|
| Molecular weight | 242.63 g/mol |
| IUPAC name | 4-(difluoromethoxy)benzenesulfonyl chloride |
| InChIKey | ANZLDHZFNLCQAS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC(F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)