Products 1341660-99-8

CAS 1341660-99-8 is the registry number for 2,3-Difluoro-4-methoxybenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

2,3-difluoro-4-methoxybenzenesulfonyl chloride (CAS 1341660-99-8) is a chemical compound with the molecular formula C7H5ClF2O3S and a molecular weight of 242.63 g/mol. IUPAC name: 2,3-difluoro-4-methoxybenzenesulfonyl chloride. InChIKey: QHBRJPVAHORYOY-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5ClF2O3S
Molecular weight242.63 g/mol
IUPAC name2,3-difluoro-4-methoxybenzenesulfonyl chloride
InChIKeyQHBRJPVAHORYOY-UHFFFAOYSA-N
SMILESCOC1=C(C(=C(C=C1)S(=O)(=O)Cl)F)F

Computed by PubChem (NCBI)