CAS 1208074-96-7 appears in our catalog under these names: 2,3-Difluoro-6-methoxybenzenesulfonyl chloride, 95%, 2,3-Difluoro-6-methoxybenzenesulfonyl chloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
2,3-difluoro-6-methoxybenzenesulfonyl chloride (CAS 1208074-96-7) is a chemical compound with the molecular formula C7H5ClF2O3S and a molecular weight of 242.63 g/mol. IUPAC name: 2,3-difluoro-6-methoxybenzenesulfonyl chloride. InChIKey: FMNCPVYTIOLWAQ-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF2O3S |
|---|---|
| Molecular weight | 242.63 g/mol |
| IUPAC name | 2,3-difluoro-6-methoxybenzenesulfonyl chloride |
| InChIKey | FMNCPVYTIOLWAQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)