cas: 611-08-5 — see every product listed under this CAS number, including other names
2,4-Dihydroxy-5-nitropyrimidine 98% (CAS 611-08-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A139617-5g |
| cas | 611-08-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 10g | 136.75 Pln | |
| Ambeed | 25g | 159.00 Pln | |
| Ambeed | 100g | 253.56 Pln | |
| Ambeed | 500g | 731.94 Pln | |
| Ambeed | 1000g | 1382.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A139617 |
5-nitrouracil is a C-nitro compound consisting of uracil having a nitro group at the 5-position. It is functionally related to a uracil.
Source: ChEBI
| Molecular formula | C4H3N3O4 |
|---|---|
| Molecular weight | 157.08 g/mol |
| IUPAC name | 5-nitro-1H-pyrimidine-2,4-dione |
| InChIKey | TUARVSWVPPVUGS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC(=O)N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)