cas: 611-08-5 — see every product listed under this CAS number, including other names
5-Nitrouracil, 99.98% (CAS 611-08-5) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 100 g, 500 g, 50 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W017265-25 g |
| cas | 611-08-5 |
| size | 25 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 250.03 Pln | |
| MedChemExpress | 100 g | 449.72 Pln | |
| MedChemExpress | 500 g | 941.99 Pln | |
| MedChemExpress | 50 g | 324.34 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.98% |
5-nitrouracil is a C-nitro compound consisting of uracil having a nitro group at the 5-position. It is functionally related to a uracil.
Source: ChEBI
| Molecular formula | C4H3N3O4 |
|---|---|
| Molecular weight | 157.08 g/mol |
| IUPAC name | 5-nitro-1H-pyrimidine-2,4-dione |
| InChIKey | TUARVSWVPPVUGS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC(=O)N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)