cas: 611-08-5 — see every product listed under this CAS number, including other names
5-Nitrouracil, 97% (CAS 611-08-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F036433-25G |
| cas | 611-08-5 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 102.07 Pln | |
| Fluorochem | 100g | 185.37 Pln | |
| Fluorochem | 500g | 596.68 Pln | |
| Fluorochem | 1kg | 1096.51 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
5-nitrouracil is a C-nitro compound consisting of uracil having a nitro group at the 5-position. It is functionally related to a uracil.
Source: ChEBI
| Molecular formula | C4H3N3O4 |
|---|---|
| Molecular weight | 157.08 g/mol |
| IUPAC name | 5-nitro-1H-pyrimidine-2,4-dione |
| InChIKey | TUARVSWVPPVUGS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC(=O)N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)