cas: 14300-45-9 — see every product listed under this CAS number, including other names
2,4-Dihydroxy-6-methoxyquinoline 95% (CAS 14300-45-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A152414-100mg |
| cas | 14300-45-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 464.94 Pln | |
| Ambeed | 5g | 1460.62 Pln | |
| Ambeed | 10g | 2267.19 Pln | |
| Ambeed | 25g | 5565.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A152414 |
4-hydroxy-6-methoxy-1H-quinolin-2-one (CAS 14300-45-9) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 4-hydroxy-6-methoxy-1H-quinolin-2-one. InChIKey: HBHIHNYMVBNMOI-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 4-hydroxy-6-methoxy-1H-quinolin-2-one |
| InChIKey | HBHIHNYMVBNMOI-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC(=O)C=C2O |
Computed by PubChem (NCBI)