cas: 54718-39-7 — see every product listed under this CAS number, including other names
2,5,6-Trichloronicotinic acid 97% (CAS 54718-39-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A501134-250mg |
| cas | 54718-39-7 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 331.44 Pln | |
| Ambeed | 10g | 565.06 Pln | |
| Ambeed | 25g | 1215.88 Pln | |
| Ambeed | 100g | 3312.94 Pln | |
| Ambeed | 500g | 13036.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A501134 |
2,5,6-trichloropyridine-3-carboxylic acid (CAS 54718-39-7) is a chemical compound with the molecular formula C6H2Cl3NO2 and a molecular weight of 226.4 g/mol. IUPAC name: 2,5,6-trichloropyridine-3-carboxylic acid. InChIKey: XMJRZCYSCMZVJQ-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl3NO2 |
|---|---|
| Molecular weight | 226.4 g/mol |
| IUPAC name | 2,5,6-trichloropyridine-3-carboxylic acid |
| InChIKey | XMJRZCYSCMZVJQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=C1Cl)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)