CAS 406676-18-4 appears in our catalog under these names: 2,3,5–Trichloroisonicotinic acid, 2,3,5-Trichloroisonicotinic acid 95%, 2,3,5-Trichloroisonicotinic acid, 98%, 98%, 2,3,5-Trichloroisonicotinic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 100g.
2,3,5-trichloropyridine-4-carboxylic acid (CAS 406676-18-4) is a chemical compound with the molecular formula C6H2Cl3NO2 and a molecular weight of 226.4 g/mol. IUPAC name: 2,3,5-trichloropyridine-4-carboxylic acid. InChIKey: TYMTYHMQJHSRIF-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl3NO2 |
|---|---|
| Molecular weight | 226.4 g/mol |
| IUPAC name | 2,3,5-trichloropyridine-4-carboxylic acid |
| InChIKey | TYMTYHMQJHSRIF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)Cl)Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)