Products 847608-28-0
CAS 847608-28-0 appears in our catalog under these names: 4,5,6-Trichloronicotinic acid 95%, 4,5,6-Trichloronicotinic acid, ≥95%, ≥95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
4,5,6-trichloropyridine-3-carboxylic acid (CAS 847608-28-0) is a chemical compound with the molecular formula C6H2Cl3NO2 and a molecular weight of 226.4 g/mol. IUPAC name: 4,5,6-trichloropyridine-3-carboxylic acid. InChIKey: GDRLWCPMLULBNF-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl3NO2 |
|---|---|
| Molecular weight | 226.4 g/mol |
| IUPAC name | 4,5,6-trichloropyridine-3-carboxylic acid |
| InChIKey | GDRLWCPMLULBNF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)Cl)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)