CAS 69422-72-6 appears in our catalog under these names: 2,4,6–Trichloropyridine–3–carboxylic Acid, 2,4,6-Trichloronicotinic acid, 2,4,6-Trichloronicotinic acid, 98%, 98%, 2,4,6-Trichloronicotinic acid, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 10g, 25g, 100g, 100mg, 5g.
2,4,6-trichloropyridine-3-carboxylic acid (CAS 69422-72-6) is a chemical compound with the molecular formula C6H2Cl3NO2 and a molecular weight of 226.4 g/mol. IUPAC name: 2,4,6-trichloropyridine-3-carboxylic acid. InChIKey: XORBTGOVTLGEOU-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl3NO2 |
|---|---|
| Molecular weight | 226.4 g/mol |
| IUPAC name | 2,4,6-trichloropyridine-3-carboxylic acid |
| InChIKey | XORBTGOVTLGEOU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1Cl)Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)