CAS 54718-39-7 appears in our catalog under these names: 2,5,6-Trichloronicotinic acid 97%, 2,5,6-Trichloronicotinic Acid, 98%, 98%, 2,5,6-Trichloronicotinic acid, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 50g.
2,5,6-trichloropyridine-3-carboxylic acid (CAS 54718-39-7) is a chemical compound with the molecular formula C6H2Cl3NO2 and a molecular weight of 226.4 g/mol. IUPAC name: 2,5,6-trichloropyridine-3-carboxylic acid. InChIKey: XMJRZCYSCMZVJQ-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl3NO2 |
|---|---|
| Molecular weight | 226.4 g/mol |
| IUPAC name | 2,5,6-trichloropyridine-3-carboxylic acid |
| InChIKey | XMJRZCYSCMZVJQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=C1Cl)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)