CAS 496849-77-5 appears in our catalog under these names: 4,5,6-trichloropicolinic acid, 4,5,6-Trichloropicolinic acid, 95+%, 4,5,6-Trichloro-2-pyridinecarboxylic acid, >95%, >95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
4,5,6-trichloropyridine-2-carboxylic acid (CAS 496849-77-5) is a chemical compound with the molecular formula C6H2Cl3NO2 and a molecular weight of 226.4 g/mol. IUPAC name: 4,5,6-trichloropyridine-2-carboxylic acid. InChIKey: LHGHJAGVMNLDGA-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl3NO2 |
|---|---|
| Molecular weight | 226.4 g/mol |
| IUPAC name | 4,5,6-trichloropyridine-2-carboxylic acid |
| InChIKey | LHGHJAGVMNLDGA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1C(=O)O)Cl)Cl)Cl |
Computed by PubChem (NCBI)