cas: 88912-26-9 — see every product listed under this CAS number, including other names
2,5-Dichloroisonicotinic Acid, >98.0%(T)(GC) (CAS 88912-26-9) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D2599-500MG |
| cas | 88912-26-9 |
| size | 500mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 500mg | 147.85 Pln | |
| TCI | 5g | 1209.97 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T)(GC) |
2,5-dichloropyridine-4-carboxylic acid (CAS 88912-26-9) is a chemical compound with the molecular formula C6H3Cl2NO2 and a molecular weight of 192.00 g/mol. IUPAC name: 2,5-dichloropyridine-4-carboxylic acid. InChIKey: GFOVTTQVBDEYPP-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO2 |
|---|---|
| Molecular weight | 192.00 g/mol |
| IUPAC name | 2,5-dichloropyridine-4-carboxylic acid |
| InChIKey | GFOVTTQVBDEYPP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)