cas: 88912-26-9 — see every product listed under this CAS number, including other names
2,5-Dichloroisonicotinic acid, 95% (CAS 88912-26-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g, 5g, 100g, 1g, 10g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | PY-1186-25g |
| cas | 88912-26-9 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 500g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 100g | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 5g | 154.13 Pln | |
| Fluorochem | 10g | 164.54 Pln | |
| Fluorochem | 25g | 320.74 Pln | |
| Fluorochem | 100g | 1127.75 Pln | |
| Fluorochem | 500g | 5345.01 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2,5-dichloropyridine-4-carboxylic acid (CAS 88912-26-9) is a chemical compound with the molecular formula C6H3Cl2NO2 and a molecular weight of 192.00 g/mol. IUPAC name: 2,5-dichloropyridine-4-carboxylic acid. InChIKey: GFOVTTQVBDEYPP-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO2 |
|---|---|
| Molecular weight | 192.00 g/mol |
| IUPAC name | 2,5-dichloropyridine-4-carboxylic acid |
| InChIKey | GFOVTTQVBDEYPP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)