cas: 88912-26-9 — see every product listed under this CAS number, including other names
2,5-Dichloroisonicotinic acid, 98%, 98% (CAS 88912-26-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FXS-250mg |
| cas | 88912-26-9 |
| size | 250mg |
| availability | 225g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 10g | 150.80 Pln | |
| Chemat | 25g | 280.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,5-dichloropyridine-4-carboxylic acid (CAS 88912-26-9) is a chemical compound with the molecular formula C6H3Cl2NO2 and a molecular weight of 192.00 g/mol. IUPAC name: 2,5-dichloropyridine-4-carboxylic acid. InChIKey: GFOVTTQVBDEYPP-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO2 |
|---|---|
| Molecular weight | 192.00 g/mol |
| IUPAC name | 2,5-dichloropyridine-4-carboxylic acid |
| InChIKey | GFOVTTQVBDEYPP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)