cas: 243448-17-1 — see every product listed under this CAS number, including other names
2,5-Difluoro-DL-phenylglycine, 96% (CAS 243448-17-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F342298-100MG |
| cas | 243448-17-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 471.73 Pln | |
| Fluorochem | 250mg | 747.67 Pln | |
| Fluorochem | 1g | 1575.50 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
2-amino-2-(2,5-difluorophenyl)acetic acid (CAS 243448-17-1) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: 2-amino-2-(2,5-difluorophenyl)acetic acid. InChIKey: FSTDRNWTSCJIRN-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | 2-amino-2-(2,5-difluorophenyl)acetic acid |
| InChIKey | FSTDRNWTSCJIRN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(C(=O)O)N)F |
Computed by PubChem (NCBI)