CAS 1780871-49-9 is the registry number for Methyl 3-amino-2,4-difluorobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 3-amino-2,4-difluorobenzoate (CAS 1780871-49-9) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: methyl 3-amino-2,4-difluorobenzoate. InChIKey: VTIHWTFSMWQBRK-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | methyl 3-amino-2,4-difluorobenzoate |
| InChIKey | VTIHWTFSMWQBRK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)F)N)F |
Computed by PubChem (NCBI)