cas: 30482-87-2 — see every product listed under this CAS number, including other names
2,6-Dichloro-4-methoxybenzonitrile 95% (CAS 30482-87-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A673150-1g |
| cas | 30482-87-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 236.88 Pln | |
| Ambeed | 5g | 665.19 Pln | |
| Ambeed | 25g | 2194.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A673150 |
2,6-dichloro-4-methoxybenzonitrile (CAS 30482-87-2) is a chemical compound with the molecular formula C8H5Cl2NO and a molecular weight of 202.03 g/mol. IUPAC name: 2,6-dichloro-4-methoxybenzonitrile. InChIKey: MTKOPGRUFMDVSS-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NO |
|---|---|
| Molecular weight | 202.03 g/mol |
| IUPAC name | 2,6-dichloro-4-methoxybenzonitrile |
| InChIKey | MTKOPGRUFMDVSS-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)Cl)C#N)Cl |
Computed by PubChem (NCBI)