cas: 30482-87-2 — see every product listed under this CAS number, including other names
2,6-Dichloro-4-methoxybenzonitrile, 97%, 97% (CAS 30482-87-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1141AF-250mg |
| cas | 30482-87-2 |
| size | 250mg |
| availability | 225g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 251.60 Pln | |
| Chemat | 25g | 731.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,6-dichloro-4-methoxybenzonitrile (CAS 30482-87-2) is a chemical compound with the molecular formula C8H5Cl2NO and a molecular weight of 202.03 g/mol. IUPAC name: 2,6-dichloro-4-methoxybenzonitrile. InChIKey: MTKOPGRUFMDVSS-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NO |
|---|---|
| Molecular weight | 202.03 g/mol |
| IUPAC name | 2,6-dichloro-4-methoxybenzonitrile |
| InChIKey | MTKOPGRUFMDVSS-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)Cl)C#N)Cl |
Computed by PubChem (NCBI)