cas: 62774-90-7 — see every product listed under this CAS number, including other names
2,6-Dichloro-4-methyl-3-pyridinecarboxylic Acid, 98%, 98% (CAS 62774-90-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 1kg, 5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114427-1g |
| cas | 62774-90-7 |
| size | 1g |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 136.40 Pln | |
| Chemat | 25g | 165.20 Pln | |
| Chemat | 100g | 491.60 Pln | |
| Chemat | 1kg | 4086.80 Pln | |
| Chemat | 5kg | 19665.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,6-dichloro-4-methylpyridine-3-carboxylic acid (CAS 62774-90-7) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 2,6-dichloro-4-methylpyridine-3-carboxylic acid. InChIKey: QOSNTWMXACGOMD-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 2,6-dichloro-4-methylpyridine-3-carboxylic acid |
| InChIKey | QOSNTWMXACGOMD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)