cas: 62774-90-7 — see every product listed under this CAS number, including other names
2,6-Dichloro-4-methyl-3-pyridinecarboxylic acid, 97% (CAS 62774-90-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F078000-5G |
| cas | 62774-90-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 10g | 169.75 Pln | |
| Fluorochem | 25g | 247.85 Pln | |
| Fluorochem | 100g | 758.08 Pln | |
| Fluorochem | 500g | 2611.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2,6-dichloro-4-methylpyridine-3-carboxylic acid (CAS 62774-90-7) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 2,6-dichloro-4-methylpyridine-3-carboxylic acid. InChIKey: QOSNTWMXACGOMD-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 2,6-dichloro-4-methylpyridine-3-carboxylic acid |
| InChIKey | QOSNTWMXACGOMD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)