cas: 16492-28-7 — see every product listed under this CAS number, including other names
2,6-Dichloropyrimidine-4-carboxylic acid 97% (CAS 16492-28-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A648913-1g |
| cas | 16492-28-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 476.06 Pln | |
| Ambeed | 10g | 815.38 Pln | |
| Ambeed | 25g | 1916.75 Pln | |
| Ambeed | 100g | 4998.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A648913 |
2,6-dichloropyrimidine-4-carboxylic acid (CAS 16492-28-7) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 2,6-dichloropyrimidine-4-carboxylic acid. InChIKey: MOXUTXQEKYPKKS-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 2,6-dichloropyrimidine-4-carboxylic acid |
| InChIKey | MOXUTXQEKYPKKS-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(N=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)