cas: 651734-56-4 — see every product listed under this CAS number, including other names
2,6-Difluoro-3,5-dimethoxybenzoic acid, 95%, 95% (CAS 651734-56-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IBGS-100mg |
| cas | 651734-56-4 |
| size | 100mg |
| availability | 0.9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 890.00 Pln | |
| Chemat | 250mg | 1442.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2,6-difluoro-3,5-dimethoxybenzoic acid (CAS 651734-56-4) is a chemical compound with the molecular formula C9H8F2O4 and a molecular weight of 218.15 g/mol. IUPAC name: 2,6-difluoro-3,5-dimethoxybenzoic acid. InChIKey: AHKXIHJVTQDRJR-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O4 |
|---|---|
| Molecular weight | 218.15 g/mol |
| IUPAC name | 2,6-difluoro-3,5-dimethoxybenzoic acid |
| InChIKey | AHKXIHJVTQDRJR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1F)C(=O)O)F)OC |
Computed by PubChem (NCBI)