Products 2179038-37-8
CAS 2179038-37-8 appears in our catalog under these names: 2,3-Difluoro-6-(methoxymethoxy)benzoic acid, 95%, 2,3-Difluoro-6-(methoxymethoxy)benzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
2,3-difluoro-6-(methoxymethoxy)benzoic acid (CAS 2179038-37-8) is a chemical compound with the molecular formula C9H8F2O4 and a molecular weight of 218.15 g/mol. IUPAC name: 2,3-difluoro-6-(methoxymethoxy)benzoic acid. InChIKey: FRXDULOIPLZOHO-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O4 |
|---|---|
| Molecular weight | 218.15 g/mol |
| IUPAC name | 2,3-difluoro-6-(methoxymethoxy)benzoic acid |
| InChIKey | FRXDULOIPLZOHO-UHFFFAOYSA-N |
| SMILES | COCOC1=C(C(=C(C=C1)F)F)C(=O)O |
Computed by PubChem (NCBI)