CAS 1214384-68-5 appears in our catalog under these names: 2-(Difluoromethoxy)mandelic acid, 98%, 2-(2-(Difluoromethoxy)phenyl)-2-hydroxyacetic acid, 95%, 95%, 2-(2-(Difluoromethoxy)phenyl)-2-hydroxyacetic acid, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 50mg, 100mg, 250mg, 1g, 500mg, 2.5g.
2-[2-(difluoromethoxy)phenyl]-2-hydroxyacetic acid (CAS 1214384-68-5) is a chemical compound with the molecular formula C9H8F2O4 and a molecular weight of 218.15 g/mol. IUPAC name: 2-[2-(difluoromethoxy)phenyl]-2-hydroxyacetic acid. InChIKey: MCWJRNAZWINLDU-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O4 |
|---|---|
| Molecular weight | 218.15 g/mol |
| IUPAC name | 2-[2-(difluoromethoxy)phenyl]-2-hydroxyacetic acid |
| InChIKey | MCWJRNAZWINLDU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)O)OC(F)F |
Computed by PubChem (NCBI)