Products 2379322-78-6

CAS 2379322-78-6 is the registry number for 2,3-Difluoro-4,5-dimethoxybenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2,3-difluoro-4,5-dimethoxybenzoic acid (CAS 2379322-78-6) is a chemical compound with the molecular formula C9H8F2O4 and a molecular weight of 218.15 g/mol. IUPAC name: 2,3-difluoro-4,5-dimethoxybenzoic acid. InChIKey: IBNKHPMMYNQRLM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8F2O4
Molecular weight218.15 g/mol
IUPAC name2,3-difluoro-4,5-dimethoxybenzoic acid
InChIKeyIBNKHPMMYNQRLM-UHFFFAOYSA-N
SMILESCOC1=C(C(=C(C(=C1)C(=O)O)F)F)OC

Computed by PubChem (NCBI)