CAS 2379322-78-6 is the registry number for 2,3-Difluoro-4,5-dimethoxybenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
2,3-difluoro-4,5-dimethoxybenzoic acid (CAS 2379322-78-6) is a chemical compound with the molecular formula C9H8F2O4 and a molecular weight of 218.15 g/mol. IUPAC name: 2,3-difluoro-4,5-dimethoxybenzoic acid. InChIKey: IBNKHPMMYNQRLM-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O4 |
|---|---|
| Molecular weight | 218.15 g/mol |
| IUPAC name | 2,3-difluoro-4,5-dimethoxybenzoic acid |
| InChIKey | IBNKHPMMYNQRLM-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1)C(=O)O)F)F)OC |
Computed by PubChem (NCBI)