CAS 651734-56-4 appears in our catalog under these names: 2,6-Difluoro-3,5-dimethoxybenzoic acid, 95%, 2,6–Difluoro–3,5–dimethoxybenzoic acid, 2,6-Difluoro-3,5-dimethoxybenzoic acid, 95%, 95%, 2,6-DIFLUORO-3,5-DIMETHOXYBENZOIC ACID, ≥95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
2,6-difluoro-3,5-dimethoxybenzoic acid (CAS 651734-56-4) is a chemical compound with the molecular formula C9H8F2O4 and a molecular weight of 218.15 g/mol. IUPAC name: 2,6-difluoro-3,5-dimethoxybenzoic acid. InChIKey: AHKXIHJVTQDRJR-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O4 |
|---|---|
| Molecular weight | 218.15 g/mol |
| IUPAC name | 2,6-difluoro-3,5-dimethoxybenzoic acid |
| InChIKey | AHKXIHJVTQDRJR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1F)C(=O)O)F)OC |
Computed by PubChem (NCBI)