CAS 162401-59-4 is the registry number for 4-Difluoromethoxy-3-methoxy-benzoic acid, 95%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg.
4-(difluoromethoxy)-3-methoxybenzoic acid (CAS 162401-59-4) is a chemical compound with the molecular formula C9H8F2O4 and a molecular weight of 218.15 g/mol. IUPAC name: 4-(difluoromethoxy)-3-methoxybenzoic acid. InChIKey: QEZBOPWZULAPBJ-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O4 |
|---|---|
| Molecular weight | 218.15 g/mol |
| IUPAC name | 4-(difluoromethoxy)-3-methoxybenzoic acid |
| InChIKey | QEZBOPWZULAPBJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)O)OC(F)F |
Computed by PubChem (NCBI)