Products 1806319-25-4
CAS 1806319-25-4 is the registry number for 2-(2,3-Difluoro-6-methoxyphenyl)-2-hydroxyacetic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,3-difluoro-6-methoxyphenyl)-2-hydroxyacetic acid (CAS 1806319-25-4) is a chemical compound with the molecular formula C9H8F2O4 and a molecular weight of 218.15 g/mol. IUPAC name: 2-(2,3-difluoro-6-methoxyphenyl)-2-hydroxyacetic acid. InChIKey: AEBZUPPHPCZINZ-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O4 |
|---|---|
| Molecular weight | 218.15 g/mol |
| IUPAC name | 2-(2,3-difluoro-6-methoxyphenyl)-2-hydroxyacetic acid |
| InChIKey | AEBZUPPHPCZINZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)F)F)C(C(=O)O)O |
Computed by PubChem (NCBI)