Products 1261440-65-6

CAS 1261440-65-6 is the registry number for 2-(2,6-Difluoro-4-methoxyphenyl)-2-hydroxyacetic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(2,6-difluoro-4-methoxyphenyl)-2-hydroxyacetic acid (CAS 1261440-65-6) is a chemical compound with the molecular formula C9H8F2O4 and a molecular weight of 218.15 g/mol. IUPAC name: 2-(2,6-difluoro-4-methoxyphenyl)-2-hydroxyacetic acid. InChIKey: UEKGYLMVMSREKD-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8F2O4
Molecular weight218.15 g/mol
IUPAC name2-(2,6-difluoro-4-methoxyphenyl)-2-hydroxyacetic acid
InChIKeyUEKGYLMVMSREKD-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C(=C1)F)C(C(=O)O)O)F

Computed by PubChem (NCBI)