Products 102331-54-4
CAS 102331-54-4 is the registry number for 2,9-Dimethyl-1,10-phenanthroline-5,6-dione, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,9-dimethyl-1,10-phenanthroline-5,6-dione (CAS 102331-54-4) is a chemical compound with the molecular formula C14H10N2O2 and a molecular weight of 238.24 g/mol. IUPAC name: 2,9-dimethyl-1,10-phenanthroline-5,6-dione. InChIKey: VNAPNEVIDUOCSG-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O2 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 2,9-dimethyl-1,10-phenanthroline-5,6-dione |
| InChIKey | VNAPNEVIDUOCSG-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C(=O)C(=O)C3=C2N=C(C=C3)C |
Computed by PubChem (NCBI)