CAS 131862-27-6 is the registry number for 2-Phenyl-imidazo[1,2-a]pyridine-8-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2-phenylimidazo[1,2-a]pyridine-8-carboxylic acid (CAS 131862-27-6) is a chemical compound with the molecular formula C14H10N2O2 and a molecular weight of 238.24 g/mol. IUPAC name: 2-phenylimidazo[1,2-a]pyridine-8-carboxylic acid. InChIKey: KWBNZRKTIVPZIC-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O2 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 2-phenylimidazo[1,2-a]pyridine-8-carboxylic acid |
| InChIKey | KWBNZRKTIVPZIC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN3C=CC=C(C3=N2)C(=O)O |
Computed by PubChem (NCBI)