CAS 140661-40-1 appears in our catalog under these names: (E)-4,4'-(Diazene-1,2-diyl)dibenzaldehyde, 95%, (E)-4,4'-(Diazene-1,2-diyl)dibenzaldehyde, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 5g, 1g.
4-[(4-formylphenyl)diazenyl]benzaldehyde (CAS 140661-40-1) is a chemical compound with the molecular formula C14H10N2O2 and a molecular weight of 238.24 g/mol. IUPAC name: 4-[(4-formylphenyl)diazenyl]benzaldehyde. InChIKey: QRHDFPNRGBRHTC-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O2 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 4-[(4-formylphenyl)diazenyl]benzaldehyde |
| InChIKey | QRHDFPNRGBRHTC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)N=NC2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)