CAS 49546-41-0 appears in our catalog under these names: 2,7-Diaminophenanthraquinone, 95%, 2,7-Diaminophenanthrene-9,10-dione 97%, 2,7-Diaminophenanthrene-9,10-dione, 97%, 97%, 2,7-DIAMINO-9,10-DIHYDROPHENANTHRENE-9,10-DIONE, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 50mg, 250mg, 1g.
2,7-diaminophenanthrene-9,10-dione (CAS 49546-41-0) is a chemical compound with the molecular formula C14H10N2O2 and a molecular weight of 238.24 g/mol. IUPAC name: 2,7-diaminophenanthrene-9,10-dione. InChIKey: FIPYLFQPDJPOKA-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O2 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 2,7-diaminophenanthrene-9,10-dione |
| InChIKey | FIPYLFQPDJPOKA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)C(=O)C(=O)C3=C2C=CC(=C3)N |
Computed by PubChem (NCBI)