CAS 603-23-6 appears in our catalog under these names: 3-Phenyl-2,4(1H,3H)-quinazolinedione, 96%, 3-Phenylquinazoline-2,4(1H,3H)-dione, 95+%, 3-Phenylquinazoline-2,4(1H,3H)-dione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 250mg, 10000mg.
3-phenyl-1H-quinazoline-2,4-dione (CAS 603-23-6) is a chemical compound with the molecular formula C14H10N2O2 and a molecular weight of 238.24 g/mol. IUPAC name: 3-phenyl-1H-quinazoline-2,4-dione. InChIKey: BHQNJNLXFVJFFI-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O2 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 3-phenyl-1H-quinazoline-2,4-dione |
| InChIKey | BHQNJNLXFVJFFI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C3=CC=CC=C3NC2=O |
Computed by PubChem (NCBI)