CAS 1758-68-5 appears in our catalog under these names: 1,2-Diaminoanthraquinone, 95%, 1,2–Diaminoanthraquinone, 1,2-Diaminoanthracene-9,10-dione, >90.0%(HPLC)(T), 1,2-Diaminoanthraquinone 92%, 1,2-DIAMINOANTHRAQUINONE. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 25g, 5g, 100g, 500g, 250 mg, 100 mg, 50 mg.
1,2-diaminoanthracene-9,10-dione (CAS 1758-68-5) is a chemical compound with the molecular formula C14H10N2O2 and a molecular weight of 238.24 g/mol. IUPAC name: 1,2-diaminoanthracene-9,10-dione. InChIKey: LRMDXTVKVHKWEK-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O2 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 1,2-diaminoanthracene-9,10-dione |
| InChIKey | LRMDXTVKVHKWEK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=C(C=C3)N)N |
Computed by PubChem (NCBI)