CAS 605-44-7 appears in our catalog under these names: 2,7-Diaminoanthraquinone, 95%, 2,7-Diaminoanthracene-9,10-dione, 97%, 2,7-Diaminoanthracene-9,10-dione, >97%, >97%, 2,7-DIAMINOANTHRAQUINONE, >97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g.
2,7-diaminoanthracene-9,10-dione (CAS 605-44-7) is a chemical compound with the molecular formula C14H10N2O2 and a molecular weight of 238.24 g/mol. IUPAC name: 2,7-diaminoanthracene-9,10-dione. InChIKey: KJNHYKBXQOSFJR-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O2 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 2,7-diaminoanthracene-9,10-dione |
| InChIKey | KJNHYKBXQOSFJR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)C(=O)C3=C(C2=O)C=CC(=C3)N |
Computed by PubChem (NCBI)