CAS 36932-61-3 appears in our catalog under these names: 2-(6-Methylpyridin-2-yl)isoindoline-1,3-dione, 95%, 2-(6-Methylpyridin-2-yl)isoindoline-1,3-dione, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
2-(6-methyl-2-pyridinyl)isoindole-1,3-dione (CAS 36932-61-3) is a chemical compound with the molecular formula C14H10N2O2 and a molecular weight of 238.24 g/mol. IUPAC name: 2-(6-methyl-2-pyridinyl)isoindole-1,3-dione. InChIKey: CFNKFWRAPXKASS-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O2 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 2-(6-methyl-2-pyridinyl)isoindole-1,3-dione |
| InChIKey | CFNKFWRAPXKASS-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)