cas: 7314-43-4 — see every product listed under this CAS number, including other names
2–Amino–2–(3–methoxyphenyl)acetic acid (CAS 7314-43-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10g, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB54318-100 |
| cas | 7314-43-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 671.93 Pln | |
| GLPBio | 10g | 4280.59 Pln | |
| GLPBio | 1g | 1271.03 Pln | |
| GLPBio | 250mg | 845.11 Pln | |
| GLPBio | 5g | 2988.78 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-amino-2-(3-methoxyphenyl)acetic acid (CAS 7314-43-4) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 2-amino-2-(3-methoxyphenyl)acetic acid. InChIKey: UMKVNPOZWRHJPM-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 2-amino-2-(3-methoxyphenyl)acetic acid |
| InChIKey | UMKVNPOZWRHJPM-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C(C(=O)O)N |
Computed by PubChem (NCBI)